Careers360 Logo
Entropy

Entropy

Edited By Vishal kumar | Updated on Sep 10, 2024 08:26 PM IST

Entropy is a concept in thermodynamics that measures the disorder or randomness within a system. It's crucial to understand why certain processes happen spontaneously and others do not. For students preparing for board exams and competitive exams like JEE and NEET, mastering entropy is essential because it helps explain phenomena in chemistry, physics, and biology. This article simplifies the concept of entropy and includes a solved example to illustrate how it affects real-world systems, providing a practical understanding that can be applied in exams and beyond.

This Story also Contains
  1. What is Entropy?
  2. 2. Entropy for an ideal gas
  3. Solved Examples Based on Entropy
  4. Summary

What is Entropy?

Entropy is a measure of the disorder of the molecular motion of a system. i.e Greater is the disorder, greater is the entropy.

The change in entropy is given as

dS= Heat absorbed by system  Absolute temperature  or dS=dQT

The relation dS=dQT is called the mathematical form of the Second Law of Thermodynamics

1. Entropy for solid and liquid

i. When heat is given to a substance to change its state at a constant temperature.

Then change in entropy is given as

dS=dQT=±mLT

where the positive sign refers to heat absorption and the negative sign to heat evolution.

And L= Latent Heat and T is in Kelvin.

ii. When heat is given to a substance to raise its temperature from T1 to T2

Then change in entropy is given as

dS=dQT=T1T2mcdTT=mcloge(T2T1)=2.303mclog10(T2T1)

where c = specific heat capacity

2. Entropy for an ideal gas

For n mole of an ideal gas, the equation is given as PV = nRT

I.Entropy change for ideal gas in terms of T & V

From the first law of thermodynamics, we know that dQ=dW+dU
and
ΔS=dQT=nCVdT+PdVT
using PV=nRT
ΔS=nCVdT+nRTVdVT=nCVT1T2dTT+nRV1V2dVVΔS=nCVln(T2T1)+nRln(V2V1)
II. Entropy change for an ideal gas in terms of T \& P
ΔS=nCPln(T2T1)nRln(P2P1)

III. Entropy change for an ideal gas in terms of P \& V
ΔS=nCVln(P2P1)+nCPln(V2V1)

Recommended Topic Video

Solved Examples Based on Entropy

Example 1: Which of the following is incorrect regarding the first law of thermodynamics?

1) It introduces the concept of the internal energy

2) It introduces the concept of entropy

3) It is applicable to any cyclic process

4) It is a restatement of the principle of conservation of energy

Solution:

The first law of Thermodynamics

Heat imported to a body is in general used to increase internal energy and work done against external pressure.

wherein

dQ=dU+dW

Entropy
It is a measure of the disorder of molecular motion of a system.
wherein
Greater is disorder greater is entropy
dS=dQT

The concept of entropy is introduced in the second law of thermodynamics.

The first law dealt with internal energy, work, and heat energy.

It is a statement of the first law of thermodynamics.

Hence, the answer is the option (2).

Example 2: The temperature­- entropy diagram of a reversible engine cycle is given in the figure. Its efficiency is

1) 1/3
2) 2/3
3) 1/2
4) 1/4

Solution:

Entropy

It is a measure of disorder of molecular motion of a system.

wherein

Greater is disorder greater is entropy

dS= \frac{dQ}{T}

and

Efficiency of a cyclic process
η= work done per cyclic  gross heat supplied per cyclic 
wherein
Gross heat supplied implies only part of heat absorbed.
The efficiency of cycle is:
η= work done  heat absorb =Q1Q2Q1= Area of cycle  Area under AB curve η=12×T0×S0T0S0+12T0S0=13 

Example 3: If ΔQ heat is given to a substance and changes its state at constant temperature T then a change in entropy ds will be
1) ±mLT
2) ±mCT
3) ±mL
4) ±mC

Solution:

Entropy for solid and liquid

ΔS=mLTL= Latent Heat  T in kelvin dθdT=±mLT

When a substance changes its state at a constant temperature dθ=±mL where the (+ve) sign refers to heat absorption and the (-ve) sign to heat evolution

Hence, the answer is the option (1).

Example 4: When heat is given to a substance of mass m and specific heat c its temperature raise from 27C to 327C, then
1) 2.303log10(2)
2) 2.303log10(1/2)
3) log10(3/2)
4) 2.303log10(3/2)

Solution:

Entropy for solid and liquid

When heat is given to a substance to raise its temperature from T1 to T2
wherein
ΔS=msln(T2T1)s= specific heat capacity ds=2.303log[273+327273+27]=2.303log102=0.693

Hence, the answer is the option 1,

Example 5: The change in the entropy of 1 mole of an ideal gas that went through an isothermal process from the initial position to the final state is equal to

1)RlnV2V1
2) RlnV1V2
3) zero
4) RlnT

Solution:

Entropy change for an ideal gas in terms of T & V

ΔS=ncpln(T2T1)+nRln(V2V1)

For an ideal gas, we have
ΔS=ncpln(T2T1)+nRln(V2V1)
for isothermal process
loge(T2T1)=0Δs=nRloge(V2V1) for one mole of gas  So Δs=Rloge(V2V1)

Hence, the answer is the option 1.

Summary

Entropy, or the shift in the energy state accompanied by heat, is connected to a number of daily actions. It aids in a shift in heat transport and is reflected by the first, second, and third laws of thermodynamics. The more unpredictability in the system, the higher the rate of entropy; conversely, the lower the randomness of the system's molecules, the lower the entropy.

Articles

Back to top